C14H20F3N3O — CID 115582781
1-[3-[benzyl(methyl)amino]propyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 115582781) has the molecular formula C14H20F3N3O and a molecular weight of 303.33 g/mol. Its IUPAC name is 1-[3-[benzyl(methyl)amino]propyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-[benzyl(methyl)amino]propyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 115582781 |
| Molecular Formula | C14H20F3N3O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-[3-[benzyl(methyl)amino]propyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CN(CCCNC(=O)NCC(F)(F)F)Cc1ccccc1 |
| InChI | InChI=1S/C14H20F3N3O/c1-20(10-12-6-3-2-4-7-12)9-5-8-18-13(21)19-11-14(15,16)17/h2-4,6-7H,5,8-11H2,1H3,(H2,18,19,21) |
| InChIKey | WXHDKEKLYGVVFD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|