C17H31Cl2N3O — CID 119835665
(2S)-2-amino-N-[3-[benzyl(methyl)amino]propyl]-3,3-dimethylbutanamide;dihydrochloride (PubChem CID 119835665) has the molecular formula C17H31Cl2N3O and a molecular weight of 364.36 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-[benzyl(methyl)amino]propyl]-3,3-dimethylbutanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-N-[3-[benzyl(methyl)amino]propyl]-3,3-dimethylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119835665 |
| Molecular Formula | C17H31Cl2N3O |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (2S)-2-amino-N-[3-[benzyl(methyl)amino]propyl]-3,3-dimethylbutanamide;dihydrochloride |
| SMILES | CN(CCCNC(=O)[C@@H](N)C(C)(C)C)Cc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C17H29N3O.2ClH/c1-17(2,3)15(18)16(21)19-11-8-12-20(4)13-14-9-6-5-7-10-14;;/h5-7,9-10,15H,8,11-13,18H2,1-4H3,(H,19,21);2*1H/t15-;;/m1../s1 |
| InChIKey | DIUSGNHEAMNEFD-QCUBGVIVSA-N |
| XLogP | 2.84 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|