C18H29ClN2O3 — CID 11792629
tert-butyl N-[3-[benzyl-[(2R)-3-chloro-2-hydroxypropyl]amino]propyl]carbamate (PubChem CID 11792629) has the molecular formula C18H29ClN2O3 and a molecular weight of 356.89 g/mol. Its IUPAC name is tert-butyl N-[3-[benzyl-[(2R)-3-chloro-2-hydroxypropyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[benzyl-[(2R)-3-chloro-2-hydroxypropyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 11792629 |
| Molecular Formula | C18H29ClN2O3 |
| Molecular Weight | 356.89 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | tert-butyl N-[3-[benzyl-[(2R)-3-chloro-2-hydroxypropyl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN(Cc1ccccc1)C[C@@H](O)CCl |
| InChI | InChI=1S/C18H29ClN2O3/c1-18(2,3)24-17(23)20-10-7-11-21(14-16(22)12-19)13-15-8-5-4-6-9-15/h4-6,8-9,16,22H,7,10-14H2,1-3H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | CSKHSRDFRJMOEE-INIZCTEOSA-N |
| XLogP | 3.00 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.89 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|