C15H23NO2S — CID 71600352
tert-butyl N-(3-benzylsulfanylpropyl)carbamate (PubChem CID 71600352) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is tert-butyl N-(3-benzylsulfanylpropyl)carbamate.
| Compound Name | tert-butyl N-(3-benzylsulfanylpropyl)carbamate |
|---|---|
| PubChem CID | 71600352 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | tert-butyl N-(3-benzylsulfanylpropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCSCc1ccccc1 |
| InChI | InChI=1S/C15H23NO2S/c1-15(2,3)18-14(17)16-10-7-11-19-12-13-8-5-4-6-9-13/h4-6,8-9H,7,10-12H2,1-3H3,(H,16,17) |
| InChIKey | UZMSLJJISFFZEL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|