C14H21NO4S2 — CID 166132393
tert-butyl N-[3-(benzenesulfonylsulfanyl)propyl]carbamate (PubChem CID 166132393) has the molecular formula C14H21NO4S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is tert-butyl N-[3-(benzenesulfonylsulfanyl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(benzenesulfonylsulfanyl)propyl]carbamate |
|---|---|
| PubChem CID | 166132393 |
| Molecular Formula | C14H21NO4S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | tert-butyl N-[3-(benzenesulfonylsulfanyl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCSS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H21NO4S2/c1-14(2,3)19-13(16)15-10-7-11-20-21(17,18)12-8-5-4-6-9-12/h4-6,8-9H,7,10-11H2,1-3H3,(H,15,16) |
| InChIKey | TYWAVKCVZDCIQF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|