C13H19NO2S2 — CID 118908988
tert-butyl N-[2-(phenyldisulfanyl)ethyl]carbamate (PubChem CID 118908988) has the molecular formula C13H19NO2S2 and a molecular weight of 285.43 g/mol. Its IUPAC name is tert-butyl N-[2-(phenyldisulfanyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(phenyldisulfanyl)ethyl]carbamate |
|---|---|
| PubChem CID | 118908988 |
| Molecular Formula | C13H19NO2S2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | tert-butyl N-[2-(phenyldisulfanyl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSSc1ccccc1 |
| InChI | InChI=1S/C13H19NO2S2/c1-13(2,3)16-12(15)14-9-10-17-18-11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3,(H,14,15) |
| InChIKey | AQHHMUHASSOQSD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|