C15H21NO2S — CID 10660338
tert-butyl N-[(Z)-2-phenylsulfanylbut-2-enyl]carbamate (PubChem CID 10660338) has the molecular formula C15H21NO2S and a molecular weight of 279.40 g/mol. Its IUPAC name is tert-butyl N-[(Z)-2-phenylsulfanylbut-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-2-phenylsulfanylbut-2-enyl]carbamate |
|---|---|
| PubChem CID | 10660338 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | tert-butyl N-[(Z)-2-phenylsulfanylbut-2-enyl]carbamate |
| SMILES | C/C=C(/CNC(=O)OC(C)(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C15H21NO2S/c1-5-12(19-13-9-7-6-8-10-13)11-16-14(17)18-15(2,3)4/h5-10H,11H2,1-4H3,(H,16,17)/b12-5- |
| InChIKey | QIUJVRWBMDAXCX-XGICHPGQSA-N |
| XLogP | 4.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |