C17H22N2O4S — CID 139702010
S-[(Z)-3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]prop-1-enyl] benzenecarbothioate (PubChem CID 139702010) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is S-[(Z)-3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]prop-1-enyl] benzenecarbothioate.
| Compound Name | S-[(Z)-3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]prop-1-enyl] benzenecarbothioate |
|---|---|
| PubChem CID | 139702010 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | S-[(Z)-3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]prop-1-enyl] benzenecarbothioate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NC/C=C\SC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H22N2O4S/c1-17(2,3)23-16(22)19-12-14(20)18-10-7-11-24-15(21)13-8-5-4-6-9-13/h4-9,11H,10,12H2,1-3H3,(H,18,20)(H,19,22)/b11-7- |
| InChIKey | XGMHTHLUUPCAMN-XFFZJAGNSA-N |
| XLogP | 2.71 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|