C16H22ClN3O4 — CID 108537111
tert-butyl N-[2-[2-[(2-chlorobenzoyl)amino]ethylamino]-2-oxoethyl]carbamate (PubChem CID 108537111) has the molecular formula C16H22ClN3O4 and a molecular weight of 355.82 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[(2-chlorobenzoyl)amino]ethylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[(2-chlorobenzoyl)amino]ethylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108537111 |
| Molecular Formula | C16H22ClN3O4 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | tert-butyl N-[2-[2-[(2-chlorobenzoyl)amino]ethylamino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H22ClN3O4/c1-16(2,3)24-15(23)20-10-13(21)18-8-9-19-14(22)11-6-4-5-7-12(11)17/h4-7H,8-10H2,1-3H3,(H,18,21)(H,19,22)(H,20,23) |
| InChIKey | ISSXDGGDQZLZKK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|