C17H23ClFN3O4 — CID 108918802
tert-butyl N-[2-[3-[(2-chloro-6-fluorobenzoyl)amino]propylamino]-2-oxoethyl]carbamate (PubChem CID 108918802) has the molecular formula C17H23ClFN3O4 and a molecular weight of 387.84 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[(2-chloro-6-fluorobenzoyl)amino]propylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[(2-chloro-6-fluorobenzoyl)amino]propylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108918802 |
| Molecular Formula | C17H23ClFN3O4 |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | tert-butyl N-[2-[3-[(2-chloro-6-fluorobenzoyl)amino]propylamino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCCCNC(=O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C17H23ClFN3O4/c1-17(2,3)26-16(25)22-10-13(23)20-8-5-9-21-15(24)14-11(18)6-4-7-12(14)19/h4,6-7H,5,8-10H2,1-3H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | JXNICOURLIGJPQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|