C18H24F3N3O4 — CID 108918760
tert-butyl N-[2-oxo-2-[3-[[2-(trifluoromethyl)benzoyl]amino]propylamino]ethyl]carbamate (PubChem CID 108918760) has the molecular formula C18H24F3N3O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[3-[[2-(trifluoromethyl)benzoyl]amino]propylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[3-[[2-(trifluoromethyl)benzoyl]amino]propylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108918760 |
| Molecular Formula | C18H24F3N3O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[3-[[2-(trifluoromethyl)benzoyl]amino]propylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCCCNC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H24F3N3O4/c1-17(2,3)28-16(27)24-11-14(25)22-9-6-10-23-15(26)12-7-4-5-8-13(12)18(19,20)21/h4-5,7-8H,6,9-11H2,1-3H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | CBZOJDZXQYTFRW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|