C18H26FN3O4 — CID 108918808
tert-butyl N-[2-[3-[[2-(2-fluorophenyl)acetyl]amino]propylamino]-2-oxoethyl]carbamate (PubChem CID 108918808) has the molecular formula C18H26FN3O4 and a molecular weight of 367.42 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[[2-(2-fluorophenyl)acetyl]amino]propylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[[2-(2-fluorophenyl)acetyl]amino]propylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108918808 |
| Molecular Formula | C18H26FN3O4 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | tert-butyl N-[2-[3-[[2-(2-fluorophenyl)acetyl]amino]propylamino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCCCNC(=O)Cc1ccccc1F |
| InChI | InChI=1S/C18H26FN3O4/c1-18(2,3)26-17(25)22-12-16(24)21-10-6-9-20-15(23)11-13-7-4-5-8-14(13)19/h4-5,7-8H,6,9-12H2,1-3H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | IWIMLSAXARBUCU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|