C18H27N3O4S — CID 108921617
tert-butyl N-[3-oxo-3-[3-[(2-sulfanylbenzoyl)amino]propylamino]propyl]carbamate (PubChem CID 108921617) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[3-[(2-sulfanylbenzoyl)amino]propylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[3-[(2-sulfanylbenzoyl)amino]propylamino]propyl]carbamate |
|---|---|
| PubChem CID | 108921617 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[3-[(2-sulfanylbenzoyl)amino]propylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCCCNC(=O)c1ccccc1S |
| InChI | InChI=1S/C18H27N3O4S/c1-18(2,3)25-17(24)21-12-9-15(22)19-10-6-11-20-16(23)13-7-4-5-8-14(13)26/h4-5,7-8,26H,6,9-12H2,1-3H3,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | HBBKLJYBDLLXPM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|