C20H22ClN3O4 — CID 108916913
tert-butyl N-[2-[4-[(2-chlorobenzoyl)amino]anilino]-2-oxoethyl]carbamate (PubChem CID 108916913) has the molecular formula C20H22ClN3O4 and a molecular weight of 403.87 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(2-chlorobenzoyl)amino]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[(2-chlorobenzoyl)amino]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108916913 |
| Molecular Formula | C20H22ClN3O4 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | tert-butyl N-[2-[4-[(2-chlorobenzoyl)amino]anilino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Nc1ccc(NC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H22ClN3O4/c1-20(2,3)28-19(27)22-12-17(25)23-13-8-10-14(11-9-13)24-18(26)15-6-4-5-7-16(15)21/h4-11H,12H2,1-3H3,(H,22,27)(H,23,25)(H,24,26) |
| InChIKey | PYVOKUOFUAZOFR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |