C21H32N2O4 — CID 10981687
tert-butyl N-[(Z)-2-benzyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enyl]carbamate (PubChem CID 10981687) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is tert-butyl N-[(Z)-2-benzyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-2-benzyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enyl]carbamate |
|---|---|
| PubChem CID | 10981687 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | tert-butyl N-[(Z)-2-benzyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C=C(\CNC(=O)OC(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C21H32N2O4/c1-20(2,3)26-18(24)22-13-12-17(14-16-10-8-7-9-11-16)15-23-19(25)27-21(4,5)6/h7-12H,13-15H2,1-6H3,(H,22,24)(H,23,25)/b17-12- |
| InChIKey | NCEMWAKTPRDOMD-ATVHPVEESA-N |
| XLogP | 4.20 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|