C15H20FNO4S — CID 170972374
tert-butyl N-[(Z)-2-(benzenesulfonylmethyl)-3-fluoroprop-2-enyl]carbamate (PubChem CID 170972374) has the molecular formula C15H20FNO4S and a molecular weight of 329.39 g/mol. Its IUPAC name is tert-butyl N-[(Z)-2-(benzenesulfonylmethyl)-3-fluoroprop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-2-(benzenesulfonylmethyl)-3-fluoroprop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170972374 |
| Molecular Formula | C15H20FNO4S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | tert-butyl N-[(Z)-2-(benzenesulfonylmethyl)-3-fluoroprop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C(=C/F)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20FNO4S/c1-15(2,3)21-14(18)17-10-12(9-16)11-22(19,20)13-7-5-4-6-8-13/h4-9H,10-11H2,1-3H3,(H,17,18)/b12-9- |
| InChIKey | RRHFUWCDYAEQKQ-XFXZXTDPSA-N |
| XLogP | 2.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |