C21H24FNO3 — CID 160720200
tert-butyl N-[3-fluoro-2-[(4-phenylphenoxy)methyl]prop-2-enyl]carbamate (PubChem CID 160720200) has the molecular formula C21H24FNO3 and a molecular weight of 357.43 g/mol. Its IUPAC name is tert-butyl N-[3-fluoro-2-[(4-phenylphenoxy)methyl]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-fluoro-2-[(4-phenylphenoxy)methyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 160720200 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | tert-butyl N-[3-fluoro-2-[(4-phenylphenoxy)methyl]prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=CF)COc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24FNO3/c1-21(2,3)26-20(24)23-14-16(13-22)15-25-19-11-9-18(10-12-19)17-7-5-4-6-8-17/h4-13H,14-15H2,1-3H3,(H,23,24) |
| InChIKey | IBDQFAKNCOVRDO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |