C17H19ClFN3O3 — CID 146492877
tert-butyl N-[(E)-2-[(2-chloroquinazolin-6-yl)oxymethyl]-3-fluoroprop-2-enyl]carbamate (PubChem CID 146492877) has the molecular formula C17H19ClFN3O3 and a molecular weight of 367.81 g/mol. Its IUPAC name is tert-butyl N-[(E)-2-[(2-chloroquinazolin-6-yl)oxymethyl]-3-fluoroprop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-2-[(2-chloroquinazolin-6-yl)oxymethyl]-3-fluoroprop-2-enyl]carbamate |
|---|---|
| PubChem CID | 146492877 |
| Molecular Formula | C17H19ClFN3O3 |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | tert-butyl N-[(E)-2-[(2-chloroquinazolin-6-yl)oxymethyl]-3-fluoroprop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C(=C\F)COc1ccc2nc(Cl)ncc2c1 |
| InChI | InChI=1S/C17H19ClFN3O3/c1-17(2,3)25-16(23)21-8-11(7-19)10-24-13-4-5-14-12(6-13)9-20-15(18)22-14/h4-7,9H,8,10H2,1-3H3,(H,21,23)/b11-7+ |
| InChIKey | NIIHGROPOWQHGZ-YRNVUSSQSA-N |
| XLogP | 4.04 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |