C17H19FN2O4 — CID 175398823
tert-butyl N-[(E)-3-fluoro-2-[(2-oxoindol-5-yl)oxymethyl]prop-2-enyl]carbamate (PubChem CID 175398823) has the molecular formula C17H19FN2O4 and a molecular weight of 334.35 g/mol. Its IUPAC name is tert-butyl N-[(E)-3-fluoro-2-[(2-oxoindol-5-yl)oxymethyl]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-3-fluoro-2-[(2-oxoindol-5-yl)oxymethyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 175398823 |
| Molecular Formula | C17H19FN2O4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | tert-butyl N-[(E)-3-fluoro-2-[(2-oxoindol-5-yl)oxymethyl]prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C(=C\F)COc1ccc2c(c1)=CC(=O)N=2 |
| InChI | InChI=1S/C17H19FN2O4/c1-17(2,3)24-16(22)19-9-11(8-18)10-23-13-4-5-14-12(6-13)7-15(21)20-14/h4-8H,9-10H2,1-3H3,(H,19,22)/b11-8+ |
| InChIKey | XXSCOZRNDYYICW-DHZHZOJOSA-N |
| XLogP | 1.38 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |