C23H31FN2O5 — CID 146492867
tert-butyl N-[(E)-3-fluoro-2-[[2-(2-propan-2-yloxyethoxy)quinolin-6-yl]oxymethyl]prop-2-enyl]carbamate (PubChem CID 146492867) has the molecular formula C23H31FN2O5 and a molecular weight of 434.51 g/mol. Its IUPAC name is tert-butyl N-[(E)-3-fluoro-2-[[2-(2-propan-2-yloxyethoxy)quinolin-6-yl]oxymethyl]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-3-fluoro-2-[[2-(2-propan-2-yloxyethoxy)quinolin-6-yl]oxymethyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 146492867 |
| Molecular Formula | C23H31FN2O5 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | tert-butyl N-[(E)-3-fluoro-2-[[2-(2-propan-2-yloxyethoxy)quinolin-6-yl]oxymethyl]prop-2-enyl]carbamate |
| SMILES | CC(C)OCCOc1ccc2cc(OC/C(=C/F)CNC(=O)OC(C)(C)C)ccc2n1 |
| InChI | InChI=1S/C23H31FN2O5/c1-16(2)28-10-11-29-21-9-6-18-12-19(7-8-20(18)26-21)30-15-17(13-24)14-25-22(27)31-23(3,4)5/h6-9,12-13,16H,10-11,14-15H2,1-5H3,(H,25,27)/b17-13+ |
| InChIKey | TWNIPOZAVVYTSV-GHRIWEEISA-N |
| XLogP | 4.80 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|