C18H23FN2O3 — CID 146492865
(E)-3-fluoro-2-[[2-(2-propan-2-yloxyethoxy)quinolin-6-yl]oxymethyl]prop-2-en-1-amine (PubChem CID 146492865) has the molecular formula C18H23FN2O3 and a molecular weight of 334.39 g/mol. Its IUPAC name is (E)-3-fluoro-2-[[2-(2-propan-2-yloxyethoxy)quinolin-6-yl]oxymethyl]prop-2-en-1-amine.
| Compound Name | (E)-3-fluoro-2-[[2-(2-propan-2-yloxyethoxy)quinolin-6-yl]oxymethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 146492865 |
| Molecular Formula | C18H23FN2O3 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (E)-3-fluoro-2-[[2-(2-propan-2-yloxyethoxy)quinolin-6-yl]oxymethyl]prop-2-en-1-amine |
| SMILES | CC(C)OCCOc1ccc2cc(OC/C(=C/F)CN)ccc2n1 |
| InChI | InChI=1S/C18H23FN2O3/c1-13(2)22-7-8-23-18-6-3-15-9-16(4-5-17(15)21-18)24-12-14(10-19)11-20/h3-6,9-10,13H,7-8,11-12,20H2,1-2H3/b14-10+ |
| InChIKey | CISSJTGQEGUUFM-GXDHUFHOSA-N |
| XLogP | 3.23 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|