C18H27FN2O2 — CID 155151137
4-[(E)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-2-[2-[tert-butyl(methyl)amino]ethyl]benzaldehyde (PubChem CID 155151137) has the molecular formula C18H27FN2O2 and a molecular weight of 322.42 g/mol. Its IUPAC name is 4-[(E)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-2-[2-[tert-butyl(methyl)amino]ethyl]benzaldehyde.
| Compound Name | 4-[(E)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-2-[2-[tert-butyl(methyl)amino]ethyl]benzaldehyde |
|---|---|
| PubChem CID | 155151137 |
| Molecular Formula | C18H27FN2O2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 4-[(E)-2-(aminomethyl)-3-fluoroprop-2-enoxy]-2-[2-[tert-butyl(methyl)amino]ethyl]benzaldehyde |
| SMILES | CN(CCc1cc(OC/C(=C/F)CN)ccc1C=O)C(C)(C)C |
| InChI | InChI=1S/C18H27FN2O2/c1-18(2,3)21(4)8-7-15-9-17(6-5-16(15)12-22)23-13-14(10-19)11-20/h5-6,9-10,12H,7-8,11,13,20H2,1-4H3/b14-10+ |
| InChIKey | SKXYALMSXKWPJJ-GXDHUFHOSA-N |
| XLogP | 2.96 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|