C9H15ClFNO2 — CID 153388228
tert-butyl N-[2-(chloromethyl)-3-fluoroprop-2-enyl]carbamate (PubChem CID 153388228) has the molecular formula C9H15ClFNO2 and a molecular weight of 223.67 g/mol. Its IUPAC name is tert-butyl N-[2-(chloromethyl)-3-fluoroprop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[2-(chloromethyl)-3-fluoroprop-2-enyl]carbamate |
|---|---|
| PubChem CID | 153388228 |
| Molecular Formula | C9H15ClFNO2 |
| Molecular Weight | 223.67 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | tert-butyl N-[2-(chloromethyl)-3-fluoroprop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=CF)CCl |
| InChI | InChI=1S/C9H15ClFNO2/c1-9(2,3)14-8(13)12-6-7(4-10)5-11/h5H,4,6H2,1-3H3,(H,12,13) |
| InChIKey | VQTRUYQKRPYYTA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.67 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|