C8H13F2NO3 — CID 105462603
tert-butyl N-(3,3-difluoro-2-oxopropyl)carbamate (PubChem CID 105462603) has the molecular formula C8H13F2NO3 and a molecular weight of 209.19 g/mol. Its IUPAC name is tert-butyl N-(3,3-difluoro-2-oxopropyl)carbamate.
| Compound Name | tert-butyl N-(3,3-difluoro-2-oxopropyl)carbamate |
|---|---|
| PubChem CID | 105462603 |
| Molecular Formula | C8H13F2NO3 |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | tert-butyl N-(3,3-difluoro-2-oxopropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)C(F)F |
| InChI | InChI=1S/C8H13F2NO3/c1-8(2,3)14-7(13)11-4-5(12)6(9)10/h6H,4H2,1-3H3,(H,11,13) |
| InChIKey | CUBVRCOYWKDRBS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |