C8H17ClN2O3 — CID 91827965
tert-butyl N-[2-(methylamino)-2-oxoethyl]carbamate;hydrochloride (PubChem CID 91827965) has the molecular formula C8H17ClN2O3 and a molecular weight of 224.69 g/mol. Its IUPAC name is tert-butyl N-[2-(methylamino)-2-oxoethyl]carbamate;hydrochloride.
| Compound Name | tert-butyl N-[2-(methylamino)-2-oxoethyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 91827965 |
| Molecular Formula | C8H17ClN2O3 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | tert-butyl N-[2-(methylamino)-2-oxoethyl]carbamate;hydrochloride |
| SMILES | CNC(=O)CNC(=O)OC(C)(C)C.Cl |
| InChI | InChI=1S/C8H16N2O3.ClH/c1-8(2,3)13-7(12)10-5-6(11)9-4;/h5H2,1-4H3,(H,9,11)(H,10,12);1H |
| InChIKey | FWUFUHTVEMZQNR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |