C9H17N3O4 — CID 14236095
tert-butyl N-[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]carbamate (PubChem CID 14236095) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 14236095 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | tert-butyl N-[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCC(N)=O |
| InChI | InChI=1S/C9H17N3O4/c1-9(2,3)16-8(15)12-5-7(14)11-4-6(10)13/h4-5H2,1-3H3,(H2,10,13)(H,11,14)(H,12,15) |
| InChIKey | WCMFSDIWPNHRHT-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |