C12H26N2O3 — CID 144701048
tert-butyl N-(2-amino-2-oxoethyl)carbamate;ethane;prop-1-ene (PubChem CID 144701048) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is tert-butyl N-(2-amino-2-oxoethyl)carbamate;ethane;prop-1-ene.
| Compound Name | tert-butyl N-(2-amino-2-oxoethyl)carbamate;ethane;prop-1-ene |
|---|---|
| PubChem CID | 144701048 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | tert-butyl N-(2-amino-2-oxoethyl)carbamate;ethane;prop-1-ene |
| SMILES | C=CC.CC.CC(C)(C)OC(=O)NCC(N)=O |
| InChI | InChI=1S/C7H14N2O3.C3H6.C2H6/c1-7(2,3)12-6(11)9-4-5(8)10;1-3-2;1-2/h4H2,1-3H3,(H2,8,10)(H,9,11);3H,1H2,2H3;1-2H3 |
| InChIKey | QJEFJFIMYDNAOL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|