C11H19NO4 — CID 5386709
[(E)-but-2-enyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 5386709) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is [(E)-but-2-enyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | [(E)-but-2-enyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 5386709 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | [(E)-but-2-enyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | C/C=C/COC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19NO4/c1-5-6-7-15-9(13)8-12-10(14)16-11(2,3)4/h5-6H,7-8H2,1-4H3,(H,12,14)/b6-5+ |
| InChIKey | BESJFBPXZRWCBF-AATRIKPKSA-N |
| XLogP | 1.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|