C13H20ClNO2 — CID 123784488
tert-butyl N-(4-chloro-2,3-dimethylidenehex-4-enyl)carbamate (PubChem CID 123784488) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is tert-butyl N-(4-chloro-2,3-dimethylidenehex-4-enyl)carbamate.
| Compound Name | tert-butyl N-(4-chloro-2,3-dimethylidenehex-4-enyl)carbamate |
|---|---|
| PubChem CID | 123784488 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | tert-butyl N-(4-chloro-2,3-dimethylidenehex-4-enyl)carbamate |
| SMILES | C=C(CNC(=O)OC(C)(C)C)C(=C)C(Cl)=CC |
| InChI | InChI=1S/C13H20ClNO2/c1-7-11(14)10(3)9(2)8-15-12(16)17-13(4,5)6/h7H,2-3,8H2,1,4-6H3,(H,15,16) |
| InChIKey | ANCMIHOMDYYHLE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|