C9H14ClNO4 — CID 162625001
2-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoic acid (PubChem CID 162625001) has the molecular formula C9H14ClNO4 and a molecular weight of 235.67 g/mol. Its IUPAC name is 2-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoic acid.
| Compound Name | 2-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 162625001 |
| Molecular Formula | C9H14ClNO4 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enoic acid |
| SMILES | CC(C)(C)OC(=O)NCC=C(Cl)C(=O)O |
| InChI | InChI=1S/C9H14ClNO4/c1-9(2,3)15-8(14)11-5-4-6(10)7(12)13/h4H,5H2,1-3H3,(H,11,14)(H,12,13) |
| InChIKey | PJWBLXKXMWLKNC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|