C17H33NO4Si — CID 72816176
1-[tert-butyl(dimethyl)silyl]but-2-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 72816176) has the molecular formula C17H33NO4Si and a molecular weight of 343.54 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]but-2-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]but-2-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 72816176 |
| Molecular Formula | C17H33NO4Si |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]but-2-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CC=CC(OC(=O)CNC(=O)OC(C)(C)C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H33NO4Si/c1-10-11-14(23(8,9)17(5,6)7)21-13(19)12-18-15(20)22-16(2,3)4/h10-11,14H,12H2,1-9H3,(H,18,20) |
| InChIKey | WEFQFHCXYUPCEV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|