C17H33NO5Si — CID 24776861
[4-[tert-butyl(dimethyl)silyl]-3-oxobutan-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 24776861) has the molecular formula C17H33NO5Si and a molecular weight of 359.54 g/mol. Its IUPAC name is [4-[tert-butyl(dimethyl)silyl]-3-oxobutan-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | [4-[tert-butyl(dimethyl)silyl]-3-oxobutan-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 24776861 |
| Molecular Formula | C17H33NO5Si |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | [4-[tert-butyl(dimethyl)silyl]-3-oxobutan-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CC(OC(=O)CNC(=O)OC(C)(C)C)C(=O)C[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H33NO5Si/c1-12(13(19)11-24(8,9)17(5,6)7)22-14(20)10-18-15(21)23-16(2,3)4/h12H,10-11H2,1-9H3,(H,18,21) |
| InChIKey | JNQLVRIFZSMOPJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|