C15H29NO4 — CID 170788050
6-methylheptan-2-yl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 170788050) has the molecular formula C15H29NO4 and a molecular weight of 287.40 g/mol. Its IUPAC name is 6-methylheptan-2-yl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | 6-methylheptan-2-yl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 170788050 |
| Molecular Formula | C15H29NO4 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | 6-methylheptan-2-yl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CC(C)CCCC(C)OC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29NO4/c1-11(2)8-7-9-12(3)19-13(17)10-16-14(18)20-15(4,5)6/h11-12H,7-10H2,1-6H3,(H,16,18) |
| InChIKey | SMYWFUMOUSWYQV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |