C21H38N2O8 — CID 174174091
2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyloxy]propyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 174174091) has the molecular formula C21H38N2O8 and a molecular weight of 446.54 g/mol. Its IUPAC name is 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyloxy]propyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyloxy]propyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 174174091 |
| Molecular Formula | C21H38N2O8 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyloxy]propyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(COC(=O)CCCNC(=O)OC(C)(C)C)OC(=O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H38N2O8/c1-15(29-17(25)11-9-13-23-19(27)31-21(5,6)7)14-28-16(24)10-8-12-22-18(26)30-20(2,3)4/h15H,8-14H2,1-7H3,(H,22,26)(H,23,27) |
| InChIKey | RPRZCPULISZQSW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|