C23H37NO8 — CID 157064123
1-(2-methylprop-2-enoyloxy)propan-2-yl 8-[1-(2-methylprop-2-enoyloxy)propan-2-yloxycarbonylamino]octanoate (PubChem CID 157064123) has the molecular formula C23H37NO8 and a molecular weight of 455.55 g/mol. Its IUPAC name is 1-(2-methylprop-2-enoyloxy)propan-2-yl 8-[1-(2-methylprop-2-enoyloxy)propan-2-yloxycarbonylamino]octanoate.
| Compound Name | 1-(2-methylprop-2-enoyloxy)propan-2-yl 8-[1-(2-methylprop-2-enoyloxy)propan-2-yloxycarbonylamino]octanoate |
|---|---|
| PubChem CID | 157064123 |
| Molecular Formula | C23H37NO8 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 1-(2-methylprop-2-enoyloxy)propan-2-yl 8-[1-(2-methylprop-2-enoyloxy)propan-2-yloxycarbonylamino]octanoate |
| SMILES | C=C(C)C(=O)OCC(C)OC(=O)CCCCCCCNC(=O)OC(C)COC(=O)C(=C)C |
| InChI | InChI=1S/C23H37NO8/c1-16(2)21(26)29-14-18(5)31-20(25)12-10-8-7-9-11-13-24-23(28)32-19(6)15-30-22(27)17(3)4/h18-19H,1,3,7-15H2,2,4-6H3,(H,24,28) |
| InChIKey | CXPDTTTUXJUIOF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|