C15H28N2O4 — CID 154948695
2-[6-(methylamino)hexylcarbamoyloxy]propyl 2-methylprop-2-enoate (PubChem CID 154948695) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-[6-(methylamino)hexylcarbamoyloxy]propyl 2-methylprop-2-enoate.
| Compound Name | 2-[6-(methylamino)hexylcarbamoyloxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154948695 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 2-[6-(methylamino)hexylcarbamoyloxy]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)OC(=O)NCCCCCCNC |
| InChI | InChI=1S/C15H28N2O4/c1-12(2)14(18)20-11-13(3)21-15(19)17-10-8-6-5-7-9-16-4/h13,16H,1,5-11H2,2-4H3,(H,17,19) |
| InChIKey | GVMYMJFMNAOYBV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|