C16H24N2O8 — CID 54028946
2-[[2-(2-methylprop-2-enoyloxy)propoxycarbonylamino]methylcarbamoyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 54028946) has the molecular formula C16H24N2O8 and a molecular weight of 372.37 g/mol. Its IUPAC name is 2-[[2-(2-methylprop-2-enoyloxy)propoxycarbonylamino]methylcarbamoyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[2-(2-methylprop-2-enoyloxy)propoxycarbonylamino]methylcarbamoyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54028946 |
| Molecular Formula | C16H24N2O8 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-[[2-(2-methylprop-2-enoyloxy)propoxycarbonylamino]methylcarbamoyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)NCNC(=O)OCC(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C16H24N2O8/c1-10(2)13(19)23-6-7-24-15(21)17-9-18-16(22)25-8-12(5)26-14(20)11(3)4/h12H,1,3,6-9H2,2,4-5H3,(H,17,21)(H,18,22) |
| InChIKey | LEEYPXJXBLWFGI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|