C24H36O8 — CID 22641153
3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate;4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate (PubChem CID 22641153) has the molecular formula C24H36O8 and a molecular weight of 452.54 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate;4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate.
| Compound Name | 3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate;4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22641153 |
| Molecular Formula | C24H36O8 |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate;4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(C)OC(=O)C(=C)C.C=C(C)C(=O)OCCCCOC(=O)C(=C)C |
| InChI | InChI=1S/2C12H18O4/c1-8(2)11(13)15-7-6-10(5)16-12(14)9(3)4;1-9(2)11(13)15-7-5-6-8-16-12(14)10(3)4/h10H,1,3,6-7H2,2,4-5H3;1,3,5-8H2,2,4H3 |
| InChIKey | KITNICVXWSVQNV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|