C16H30O3 — CID 58451766
9-propan-2-yloxynonyl 2-methylprop-2-enoate (PubChem CID 58451766) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is 9-propan-2-yloxynonyl 2-methylprop-2-enoate.
| Compound Name | 9-propan-2-yloxynonyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58451766 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 9-propan-2-yloxynonyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCOC(C)C |
| InChI | InChI=1S/C16H30O3/c1-14(2)16(17)19-13-11-9-7-5-6-8-10-12-18-15(3)4/h15H,1,5-13H2,2-4H3 |
| InChIKey | DKUVCOABOSNMJD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|