C15H25ClO4 — CID 102275209
8-[(2R)-2-chloropropanoyl]oxyoctyl 2-methylprop-2-enoate (PubChem CID 102275209) has the molecular formula C15H25ClO4 and a molecular weight of 304.81 g/mol. Its IUPAC name is 8-[(2R)-2-chloropropanoyl]oxyoctyl 2-methylprop-2-enoate.
| Compound Name | 8-[(2R)-2-chloropropanoyl]oxyoctyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102275209 |
| Molecular Formula | C15H25ClO4 |
| Molecular Weight | 304.81 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 8-[(2R)-2-chloropropanoyl]oxyoctyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCOC(=O)[C@@H](C)Cl |
| InChI | InChI=1S/C15H25ClO4/c1-12(2)14(17)19-10-8-6-4-5-7-9-11-20-15(18)13(3)16/h13H,1,4-11H2,2-3H3/t13-/m1/s1 |
| InChIKey | WRTOLTHHBMSYSC-CYBMUJFWSA-N |
| XLogP | 3.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.81 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|