C12H22Cl2O2Si — CID 172804867
7-(dichloromethylsilyl)heptyl 2-methylprop-2-enoate (PubChem CID 172804867) has the molecular formula C12H22Cl2O2Si and a molecular weight of 297.30 g/mol. Its IUPAC name is 7-(dichloromethylsilyl)heptyl 2-methylprop-2-enoate.
| Compound Name | 7-(dichloromethylsilyl)heptyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 172804867 |
| Molecular Formula | C12H22Cl2O2Si |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 7-(dichloromethylsilyl)heptyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCC[SiH2]C(Cl)Cl |
| InChI | InChI=1S/C12H22Cl2O2Si/c1-10(2)11(15)16-8-6-4-3-5-7-9-17-12(13)14/h12H,1,3-9,17H2,2H3 |
| InChIKey | RJGCHSJODRGJTP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|