C31H57Cl5O4Si2 — CID 159008307
11-(dichloromethylsilyl)undecyl 2-methylprop-2-enoate;11-trichlorosilylundecyl 2-methylprop-2-enoate (PubChem CID 159008307) has the molecular formula C31H57Cl5O4Si2 and a molecular weight of 727.23 g/mol. Its IUPAC name is 11-(dichloromethylsilyl)undecyl 2-methylprop-2-enoate;11-trichlorosilylundecyl 2-methylprop-2-enoate.
| Compound Name | 11-(dichloromethylsilyl)undecyl 2-methylprop-2-enoate;11-trichlorosilylundecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159008307 |
| Molecular Formula | C31H57Cl5O4Si2 |
| Molecular Weight | 727.23 g/mol |
| Exact Mass | 724.22 |
| IUPAC Name | 11-(dichloromethylsilyl)undecyl 2-methylprop-2-enoate;11-trichlorosilylundecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCC[SiH2]C(Cl)Cl.C=C(C)C(=O)OCCCCCCCCCCC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C16H30Cl2O2Si.C15H27Cl3O2Si/c1-14(2)15(19)20-12-10-8-6-4-3-5-7-9-11-13-21-16(17)18;1-14(2)15(19)20-12-10-8-6-4-3-5-7-9-11-13-21(16,17)18/h16H,1,3-13,21H2,2H3;1,3-13H2,2H3 |
| InChIKey | JSESYGQEMGSOKD-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.23 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|