About 7-tribromosilylheptyl 2-methylprop-2-enoate
7-tribromosilylheptyl 2-methylprop-2-enoate (PubChem CID 156681371) has the molecular formula C11H19Br3O2Si
and a molecular weight of 451.07 g/mol. Its IUPAC name is 7-tribromosilylheptyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 7-tribromosilylheptyl 2-methylprop-2-enoate |
| PubChem CID | 156681371 |
| Molecular Formula | C11H19Br3O2Si |
| Molecular Weight | 451.07 g/mol |
| Exact Mass | 447.87 |
| IUPAC Name | 7-tribromosilylheptyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCC[Si](Br)(Br)Br |
| InChI | InChI=1S/C11H19Br3O2Si/c1-10(2)11(15)16-8-6-4-3-5-7-9-17(12,13)14/h1,3-9H2,2H3 |
| InChIKey | CMBIPZFVEHHECS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.07 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 7-tribromosilylheptyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tribromosilylheptyl 2-methylprop-2-enoate?
The IUPAC name of 7-tribromosilylheptyl 2-methylprop-2-enoate (CID 156681371) is 7-tribromosilylheptyl 2-methylprop-2-enoate.
What is the SMILES notation for 7-tribromosilylheptyl 2-methylprop-2-enoate?
The canonical SMILES for 7-tribromosilylheptyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCCCCCC[Si](Br)(Br)Br.
What is the InChIKey of 7-tribromosilylheptyl 2-methylprop-2-enoate?
The InChIKey is CMBIPZFVEHHECS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19Br3O2Si/c1-10(2)11(15)16-8-6-4-3-5-7-9-17(12,13)14/h1,3-9H2,2H3.
What are the key properties of 7-tribromosilylheptyl 2-methylprop-2-enoate?
7-tribromosilylheptyl 2-methylprop-2-enoate has a molecular weight of 451.07 g/mol, XLogP of 5.18, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tribromosilylheptyl 2-methylprop-2-enoate is sourced from PubChem (CID 156681371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).