C13H26O4Si — CID 154399955
5-(2,2-dimethoxyethylsilyl)pentyl 2-methylprop-2-enoate (PubChem CID 154399955) has the molecular formula C13H26O4Si and a molecular weight of 274.43 g/mol. Its IUPAC name is 5-(2,2-dimethoxyethylsilyl)pentyl 2-methylprop-2-enoate.
| Compound Name | 5-(2,2-dimethoxyethylsilyl)pentyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154399955 |
| Molecular Formula | C13H26O4Si |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 5-(2,2-dimethoxyethylsilyl)pentyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCC[SiH2]CC(OC)OC |
| InChI | InChI=1S/C13H26O4Si/c1-11(2)13(14)17-8-6-5-7-9-18-10-12(15-3)16-4/h12H,1,5-10,18H2,2-4H3 |
| InChIKey | NXNGVHWKBGWHBC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|