C14H27O2P — CID 174956599
10-phosphanyldecyl 2-methylprop-2-enoate (PubChem CID 174956599) has the molecular formula C14H27O2P and a molecular weight of 258.34 g/mol. Its IUPAC name is 10-phosphanyldecyl 2-methylprop-2-enoate.
| Compound Name | 10-phosphanyldecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174956599 |
| Molecular Formula | C14H27O2P |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 10-phosphanyldecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCP |
| InChI | InChI=1S/C14H27O2P/c1-13(2)14(15)16-11-9-7-5-3-4-6-8-10-12-17/h1,3-12,17H2,2H3 |
| InChIKey | LIHNXBCMKYWEBX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|