C13H23O7P — CID 176795551
[1-[6-(2-methylprop-2-enoyloxy)hexoxy]-1-oxopropan-2-yl]phosphonic acid (PubChem CID 176795551) has the molecular formula C13H23O7P and a molecular weight of 322.29 g/mol. Its IUPAC name is [1-[6-(2-methylprop-2-enoyloxy)hexoxy]-1-oxopropan-2-yl]phosphonic acid.
| Compound Name | [1-[6-(2-methylprop-2-enoyloxy)hexoxy]-1-oxopropan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 176795551 |
| Molecular Formula | C13H23O7P |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | [1-[6-(2-methylprop-2-enoyloxy)hexoxy]-1-oxopropan-2-yl]phosphonic acid |
| SMILES | C=C(C)C(=O)OCCCCCCOC(=O)C(C)P(=O)(O)O |
| InChI | InChI=1S/C13H23O7P/c1-10(2)12(14)19-8-6-4-5-7-9-20-13(15)11(3)21(16,17)18/h11H,1,4-9H2,2-3H3,(H2,16,17,18) |
| InChIKey | SFJGJFRYXATUNT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|