C11H19O8P — CID 87531056
3-(2-methylprop-2-enoyloxy)propyl 2-methylprop-2-enoate;phosphoric acid (PubChem CID 87531056) has the molecular formula C11H19O8P and a molecular weight of 310.24 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoyloxy)propyl 2-methylprop-2-enoate;phosphoric acid.
| Compound Name | 3-(2-methylprop-2-enoyloxy)propyl 2-methylprop-2-enoate;phosphoric acid |
|---|---|
| PubChem CID | 87531056 |
| Molecular Formula | C11H19O8P |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 3-(2-methylprop-2-enoyloxy)propyl 2-methylprop-2-enoate;phosphoric acid |
| SMILES | C=C(C)C(=O)OCCCOC(=O)C(=C)C.O=P(O)(O)O |
| InChI | InChI=1S/C11H16O4.H3O4P/c1-8(2)10(12)14-6-5-7-15-11(13)9(3)4;1-5(2,3)4/h1,3,5-7H2,2,4H3;(H3,1,2,3,4) |
| InChIKey | OVKKXMXFVOMIHS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|