C15H29O5P — CID 164973932
methyl-[10-(2-methylprop-2-enoyloxy)decoxy]phosphinic acid (PubChem CID 164973932) has the molecular formula C15H29O5P and a molecular weight of 320.37 g/mol. Its IUPAC name is methyl-[10-(2-methylprop-2-enoyloxy)decoxy]phosphinic acid.
| Compound Name | methyl-[10-(2-methylprop-2-enoyloxy)decoxy]phosphinic acid |
|---|---|
| PubChem CID | 164973932 |
| Molecular Formula | C15H29O5P |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | methyl-[10-(2-methylprop-2-enoyloxy)decoxy]phosphinic acid |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCOP(C)(=O)O |
| InChI | InChI=1S/C15H29O5P/c1-14(2)15(16)19-12-10-8-6-4-5-7-9-11-13-20-21(3,17)18/h1,4-13H2,2-3H3,(H,17,18) |
| InChIKey | XMPSEYXLOLDCBE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|