C14H29NO6P+ — CID 19378254
2-[hydroxy-[5-(2-methylprop-2-enoyloxy)pentoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 19378254) has the molecular formula C14H29NO6P+ and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-[hydroxy-[5-(2-methylprop-2-enoyloxy)pentoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[5-(2-methylprop-2-enoyloxy)pentoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 19378254 |
| Molecular Formula | C14H29NO6P+ |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-[hydroxy-[5-(2-methylprop-2-enoyloxy)pentoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | C=C(C)C(=O)OCCCCCOP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C14H28NO6P/c1-13(2)14(16)19-10-7-6-8-11-20-22(17,18)21-12-9-15(3,4)5/h1,6-12H2,2-5H3/p+1 |
| InChIKey | XFPGQQYIRWCNJV-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|