C14H29NO7P+ — CID 89310948
2-[hydroxy(2-methoxyethoxy)phosphoryl]oxyethyl-dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]azanium (PubChem CID 89310948) has the molecular formula C14H29NO7P+ and a molecular weight of 354.36 g/mol. Its IUPAC name is 2-[hydroxy(2-methoxyethoxy)phosphoryl]oxyethyl-dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]azanium.
| Compound Name | 2-[hydroxy(2-methoxyethoxy)phosphoryl]oxyethyl-dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]azanium |
|---|---|
| PubChem CID | 89310948 |
| Molecular Formula | C14H29NO7P+ |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-[hydroxy(2-methoxyethoxy)phosphoryl]oxyethyl-dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]azanium |
| SMILES | C=C(C)C(=O)OCCC[N+](C)(C)CCOP(=O)(O)OCCOC |
| InChI | InChI=1S/C14H28NO7P/c1-13(2)14(16)20-9-6-7-15(3,4)8-10-21-23(17,18)22-12-11-19-5/h1,6-12H2,2-5H3/p+1 |
| InChIKey | XYMILMGSLKUCIX-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|